About zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride
zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride (PubChem CID 170840437) has the molecular formula C16H16Cl6N3OZn-
and a molecular weight of 544.43 g/mol. Its IUPAC name is zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride.
Molecular Properties
| Compound Name | zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride |
| PubChem CID | 170840437 |
| Molecular Formula | C16H16Cl6N3OZn- |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 539.87 |
| IUPAC Name | zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride |
| SMILES | CCN(CC)c1cc(Cl)c([N+]#N)cc1Oc1ccc(Cl)cc1.[Cl-].[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C16H16Cl2N3O.4ClH.Zn/c1-3-21(4-2)15-9-13(18)14(20-19)10-16(15)22-12-7-5-11(17)6-8-12;;;;;/h5-10H,3-4H2,1-2H3;4*1H;/q+1;;;;;+2/p-4 |
| InChIKey | KDZLYIJSXXIHDR-UHFFFAOYSA-J |
| XLogP | -5.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride?
The IUPAC name of zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride (CID 170840437) is zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride.
What is the SMILES notation for zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride?
The canonical SMILES for zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride is CCN(CC)c1cc(Cl)c([N+]#N)cc1Oc1ccc(Cl)cc1.[Cl-].[Cl-].[Cl-].[Cl-].[Zn+2].
What is the InChIKey of zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride?
The InChIKey is KDZLYIJSXXIHDR-UHFFFAOYSA-J. The full InChI is InChI=1S/C16H16Cl2N3O.4ClH.Zn/c1-3-21(4-2)15-9-13(18)14(20-19)10-16(15)22-12-7-5-11(17)6-8-12;;;;;/h5-10H,3-4H2,1-2H3;4*1H;/q+1;;;;;+2/p-4.
What are the key properties of zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride?
zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride has a molecular weight of 544.43 g/mol, XLogP of -5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-chloro-5-(4-chlorophenoxy)-4-(diethylamino)benzenediazonium;tetrachloride is sourced from PubChem (CID 170840437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).