C29H36O5 — CID 170841974
[4-(4-ethylcyclohexyl)phenyl] 4-[(2R,4S)-4-prop-2-enoyloxypentan-2-yl]oxybenzoate (PubChem CID 170841974) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is [4-(4-ethylcyclohexyl)phenyl] 4-[(2R,4S)-4-prop-2-enoyloxypentan-2-yl]oxybenzoate.
| Compound Name | [4-(4-ethylcyclohexyl)phenyl] 4-[(2R,4S)-4-prop-2-enoyloxypentan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 170841974 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [4-(4-ethylcyclohexyl)phenyl] 4-[(2R,4S)-4-prop-2-enoyloxypentan-2-yl]oxybenzoate |
| SMILES | C=CC(=O)O[C@@H](C)C[C@@H](C)Oc1ccc(C(=O)Oc2ccc(C3CCC(CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H36O5/c1-5-22-7-9-23(10-8-22)24-11-15-27(16-12-24)34-29(31)25-13-17-26(18-14-25)32-20(3)19-21(4)33-28(30)6-2/h6,11-18,20-23H,2,5,7-10,19H2,1,3-4H3/t20-,21+,22?,23?/m1/s1 |
| InChIKey | CIKVBLAPVXEVNF-VNAXIPGXSA-N |
| XLogP | 6.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|