C32H26N4O5 — CID 170843879
(4E)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]hydrazinylidene]-N-(2-methoxyphenyl)-3-oxonaphthalene-2-carboximidic acid (PubChem CID 170843879) has the molecular formula C32H26N4O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is (4E)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]hydrazinylidene]-N-(2-methoxyphenyl)-3-oxonaphthalene-2-carboximidic acid.
| Compound Name | (4E)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]hydrazinylidene]-N-(2-methoxyphenyl)-3-oxonaphthalene-2-carboximidic acid |
|---|---|
| PubChem CID | 170843879 |
| Molecular Formula | C32H26N4O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | (4E)-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]hydrazinylidene]-N-(2-methoxyphenyl)-3-oxonaphthalene-2-carboximidic acid |
| SMILES | COc1ccccc1/N=C(\O)C1=Cc2ccccc2/C(=N\Nc2cc(/C(O)=N/c3ccccc3)ccc2OC)C1=O |
| InChI | InChI=1S/C32H26N4O5/c1-40-27-15-9-8-14-25(27)34-32(39)24-18-20-10-6-7-13-23(20)29(30(24)37)36-35-26-19-21(16-17-28(26)41-2)31(38)33-22-11-4-3-5-12-22/h3-19,35H,1-2H3,(H,33,38)(H,34,39)/b36-29+ |
| InChIKey | HMPZONMWIBEZSH-ZONNCAFXSA-N |
| XLogP | 6.41 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|