C19H12F3NO4 — CID 21234003
4-[2-methoxy-5-(2,2,2-trifluoroacetyl)anilino]naphthalene-1,2-dione (PubChem CID 21234003) has the molecular formula C19H12F3NO4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 4-[2-methoxy-5-(2,2,2-trifluoroacetyl)anilino]naphthalene-1,2-dione.
| Compound Name | 4-[2-methoxy-5-(2,2,2-trifluoroacetyl)anilino]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 21234003 |
| Molecular Formula | C19H12F3NO4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-[2-methoxy-5-(2,2,2-trifluoroacetyl)anilino]naphthalene-1,2-dione |
| SMILES | COc1ccc(C(=O)C(F)(F)F)cc1NC1=CC(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H12F3NO4/c1-27-16-7-6-10(18(26)19(20,21)22)8-14(16)23-13-9-15(24)17(25)12-5-3-2-4-11(12)13/h2-9,23H,1H3 |
| InChIKey | TVXMRDWPZRCAGL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|