C26H23NO2S — CID 170854739
(Z)-2-[dimethyl(oxo)-λ6-sulfanylidene]-3-(1H-indol-3-yl)-1,4-diphenylbut-3-en-1-one (PubChem CID 170854739) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is (Z)-2-[dimethyl(oxo)-λ6-sulfanylidene]-3-(1H-indol-3-yl)-1,4-diphenylbut-3-en-1-one.
| Compound Name | (Z)-2-[dimethyl(oxo)-λ6-sulfanylidene]-3-(1H-indol-3-yl)-1,4-diphenylbut-3-en-1-one |
|---|---|
| PubChem CID | 170854739 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (Z)-2-[dimethyl(oxo)-λ6-sulfanylidene]-3-(1H-indol-3-yl)-1,4-diphenylbut-3-en-1-one |
| SMILES | CS(C)(=O)=C(C(=O)c1ccccc1)/C(=C\c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H23NO2S/c1-30(2,29)26(25(28)20-13-7-4-8-14-20)22(17-19-11-5-3-6-12-19)23-18-27-24-16-10-9-15-21(23)24/h3-18,27H,1-2H3/b22-17- |
| InChIKey | DZAVFRVESKBLJE-XLNRJJMWSA-N |
| XLogP | 5.31 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|