C16H22N6S — CID 170856084
1-(1-adamantyl)-3-[(Z)-[amino(pyrazin-2-yl)methylidene]amino]thiourea (PubChem CID 170856084) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(Z)-[amino(pyrazin-2-yl)methylidene]amino]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[(Z)-[amino(pyrazin-2-yl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 170856084 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(1-adamantyl)-3-[(Z)-[amino(pyrazin-2-yl)methylidene]amino]thiourea |
| SMILES | N/C(=N\NC(=S)NC12CC3CC(CC(C3)C1)C2)c1cnccn1 |
| InChI | InChI=1S/C16H22N6S/c17-14(13-9-18-1-2-19-13)21-22-15(23)20-16-6-10-3-11(7-16)5-12(4-10)8-16/h1-2,9-12H,3-8H2,(H2,17,21)(H2,20,22,23) |
| InChIKey | RYYPIUVYSUUYCH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|