C17H23N5S — CID 5494283
1-[(E)-[1-adamantyl(pyridin-2-yl)methylidene]amino]-3-aminothiourea (PubChem CID 5494283) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-[(E)-[1-adamantyl(pyridin-2-yl)methylidene]amino]-3-aminothiourea.
| Compound Name | 1-[(E)-[1-adamantyl(pyridin-2-yl)methylidene]amino]-3-aminothiourea |
|---|---|
| PubChem CID | 5494283 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[(E)-[1-adamantyl(pyridin-2-yl)methylidene]amino]-3-aminothiourea |
| SMILES | NNC(=S)N/N=C(/c1ccccn1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H23N5S/c18-20-16(23)22-21-15(14-3-1-2-4-19-14)17-8-11-5-12(9-17)7-13(6-11)10-17/h1-4,11-13H,5-10,18H2,(H2,20,22,23)/b21-15- |
| InChIKey | HSXLNDYJUCQYJO-QNGOZBTKSA-N |
| XLogP | 2.34 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|