C15H21ClN2O2 — CID 170890664
1-(2,7-dimethoxyquinolin-3-yl)butan-2-amine;hydrochloride (PubChem CID 170890664) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-(2,7-dimethoxyquinolin-3-yl)butan-2-amine;hydrochloride.
| Compound Name | 1-(2,7-dimethoxyquinolin-3-yl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890664 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(2,7-dimethoxyquinolin-3-yl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc2ccc(OC)cc2nc1OC.Cl |
| InChI | InChI=1S/C15H20N2O2.ClH/c1-4-12(16)8-11-7-10-5-6-13(18-2)9-14(10)17-15(11)19-3;/h5-7,9,12H,4,8,16H2,1-3H3;1H |
| InChIKey | QAZUEXNIGOHPRE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |