C10H12F3NO2 — CID 170890931
2-(2-aminopropyl)-4-(trifluoromethoxy)phenol (PubChem CID 170890931) has the molecular formula C10H12F3NO2 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(2-aminopropyl)-4-(trifluoromethoxy)phenol.
| Compound Name | 2-(2-aminopropyl)-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 170890931 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(2-aminopropyl)-4-(trifluoromethoxy)phenol |
| SMILES | CC(N)Cc1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C10H12F3NO2/c1-6(14)4-7-5-8(2-3-9(7)15)16-10(11,12)13/h2-3,5-6,15H,4,14H2,1H3 |
| InChIKey | LAAAQKRAUOXUSY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |