C25H23BClNO2 — CID 170902640
3-[2-chloro-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzonitrile (PubChem CID 170902640) has the molecular formula C25H23BClNO2 and a molecular weight of 415.73 g/mol. Its IUPAC name is 3-[2-chloro-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzonitrile.
| Compound Name | 3-[2-chloro-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 170902640 |
| Molecular Formula | C25H23BClNO2 |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[2-chloro-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzonitrile |
| SMILES | CC1(C)OB(c2cc(Cl)c(-c3cccc(C#N)c3)cc2-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H23BClNO2/c1-24(2)25(3,4)30-26(29-24)22-15-23(27)21(19-12-8-9-17(13-19)16-28)14-20(22)18-10-6-5-7-11-18/h5-15H,1-4H3 |
| InChIKey | NRFDDAGYZDNSIQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|