C17H28N2O3 — CID 170903383
tert-butyl 4-[2-(4-hydroxypiperidin-4-yl)ethynyl]piperidine-1-carboxylate (PubChem CID 170903383) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-hydroxypiperidin-4-yl)ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-hydroxypiperidin-4-yl)ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170903383 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl 4-[2-(4-hydroxypiperidin-4-yl)ethynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#CC2(O)CCNCC2)CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-16(2,3)22-15(20)19-12-5-14(6-13-19)4-7-17(21)8-10-18-11-9-17/h14,18,21H,5-6,8-13H2,1-3H3 |
| InChIKey | CWVFKJGOONXYAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|