C10H17ClFN3 — CID 170906328
4-chloro-8-fluoro-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-pyrimido[5,4-b]indole (PubChem CID 170906328) has the molecular formula C10H17ClFN3 and a molecular weight of 233.72 g/mol. Its IUPAC name is 4-chloro-8-fluoro-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-pyrimido[5,4-b]indole.
| Compound Name | 4-chloro-8-fluoro-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 170906328 |
| Molecular Formula | C10H17ClFN3 |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-chloro-8-fluoro-2,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-pyrimido[5,4-b]indole |
| SMILES | FC1CCC2NC3C(Cl)NCNC3C2C1 |
| InChI | InChI=1S/C10H17ClFN3/c11-10-9-8(13-4-14-10)6-3-5(12)1-2-7(6)15-9/h5-10,13-15H,1-4H2 |
| InChIKey | IURQGSVZVPRBPF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|