C11H19ClN2O2 — CID 170915764
3-(4-tert-butyl-1,3-oxazol-2-yl)morpholine;hydrochloride (PubChem CID 170915764) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 3-(4-tert-butyl-1,3-oxazol-2-yl)morpholine;hydrochloride.
| Compound Name | 3-(4-tert-butyl-1,3-oxazol-2-yl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 170915764 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(4-tert-butyl-1,3-oxazol-2-yl)morpholine;hydrochloride |
| SMILES | CC(C)(C)c1coc(C2COCCN2)n1.Cl |
| InChI | InChI=1S/C11H18N2O2.ClH/c1-11(2,3)9-7-15-10(13-9)8-6-14-5-4-12-8;/h7-8,12H,4-6H2,1-3H3;1H |
| InChIKey | QZHNIUQQAIPDPJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |