About 7aH-1,3-benzothiazole-2-thione
7aH-1,3-benzothiazole-2-thione (PubChem CID 170920425) has the molecular formula C7H5NS2
and a molecular weight of 167.26 g/mol. Its IUPAC name is 7aH-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | 7aH-1,3-benzothiazole-2-thione |
| PubChem CID | 170920425 |
| Molecular Formula | C7H5NS2 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | 7aH-1,3-benzothiazole-2-thione |
| SMILES | S=C1N=C2C=CC=CC2S1 |
| InChI | InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4,6H |
| InChIKey | UJOSGFLGPAIPFT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7aH-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-1,3-benzothiazole-2-thione?
The IUPAC name of 7aH-1,3-benzothiazole-2-thione (CID 170920425) is 7aH-1,3-benzothiazole-2-thione.
What is the SMILES notation for 7aH-1,3-benzothiazole-2-thione?
The canonical SMILES for 7aH-1,3-benzothiazole-2-thione is S=C1N=C2C=CC=CC2S1.
What is the InChIKey of 7aH-1,3-benzothiazole-2-thione?
The InChIKey is UJOSGFLGPAIPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4,6H.
What are the key properties of 7aH-1,3-benzothiazole-2-thione?
7aH-1,3-benzothiazole-2-thione has a molecular weight of 167.26 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-1,3-benzothiazole-2-thione is sourced from PubChem (CID 170920425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).