C15H20Cl2N2O4S — CID 170923683
N-(2,4-dichloro-5-propan-2-yloxyphenyl)-2-[[2-(dimethylamino)-2-oxoethylidene]-hydroxy-λ4-sulfanyl]acetamide (PubChem CID 170923683) has the molecular formula C15H20Cl2N2O4S and a molecular weight of 395.31 g/mol. Its IUPAC name is N-(2,4-dichloro-5-propan-2-yloxyphenyl)-2-[[2-(dimethylamino)-2-oxoethylidene]-hydroxy-λ4-sulfanyl]acetamide.
| Compound Name | N-(2,4-dichloro-5-propan-2-yloxyphenyl)-2-[[2-(dimethylamino)-2-oxoethylidene]-hydroxy-λ4-sulfanyl]acetamide |
|---|---|
| PubChem CID | 170923683 |
| Molecular Formula | C15H20Cl2N2O4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(2,4-dichloro-5-propan-2-yloxyphenyl)-2-[[2-(dimethylamino)-2-oxoethylidene]-hydroxy-λ4-sulfanyl]acetamide |
| SMILES | CC(C)Oc1cc(NC(=O)CS(O)=CC(=O)N(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O4S/c1-9(2)23-13-6-12(10(16)5-11(13)17)18-14(20)7-24(22)8-15(21)19(3)4/h5-6,8-9,22H,7H2,1-4H3,(H,18,20) |
| InChIKey | OIICYIKAUZZAIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|