C17H24NO+ — CID 170935924
(3aR,9bS)-5,5,9b-trideuterio-1,2-di(propan-2-yl)-3a,4-dihydrobenzo[e][1,3]benzoxazol-1-ium (PubChem CID 170935924) has the molecular formula C17H24NO+ and a molecular weight of 261.40 g/mol. Its IUPAC name is (3aR,9bS)-5,5,9b-trideuterio-1,2-di(propan-2-yl)-3a,4-dihydrobenzo[e][1,3]benzoxazol-1-ium.
| Compound Name | (3aR,9bS)-5,5,9b-trideuterio-1,2-di(propan-2-yl)-3a,4-dihydrobenzo[e][1,3]benzoxazol-1-ium |
|---|---|
| PubChem CID | 170935924 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | (3aR,9bS)-5,5,9b-trideuterio-1,2-di(propan-2-yl)-3a,4-dihydrobenzo[e][1,3]benzoxazol-1-ium |
| SMILES | [2H]C1([2H])C[C@H]2OC(C(C)C)=[N+](C(C)C)[C@@]2([2H])c2ccccc21 |
| InChI | InChI=1S/C17H24NO/c1-11(2)17-18(12(3)4)16-14-8-6-5-7-13(14)9-10-15(16)19-17/h5-8,11-12,15-16H,9-10H2,1-4H3/q+1/t15-,16+/m1/s1/i9D2,16D |
| InChIKey | XWWYGKMJRNXSJP-XHCCPIGNSA-N |
| XLogP | 3.55 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|