C18H26NO+ — CID 170932795
(3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-4H-indeno[2,1-d][1,3]oxazol-3-ium (PubChem CID 170932795) has the molecular formula C18H26NO+ and a molecular weight of 272.41 g/mol. Its IUPAC name is (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-4H-indeno[2,1-d][1,3]oxazol-3-ium.
| Compound Name | (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-4H-indeno[2,1-d][1,3]oxazol-3-ium |
|---|---|
| PubChem CID | 170932795 |
| Molecular Formula | C18H26NO+ |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-4H-indeno[2,1-d][1,3]oxazol-3-ium |
| SMILES | CC(C)C1=[N+](C(C)C)[C@]2(C)Cc3ccccc3[C@]2(C)O1 |
| InChI | InChI=1S/C18H26NO/c1-12(2)16-19(13(3)4)17(5)11-14-9-7-8-10-15(14)18(17,6)20-16/h7-10,12-13H,11H2,1-6H3/q+1/t17-,18+/m1/s1 |
| InChIKey | CCJKBWVSAVJBEB-MSOLQXFVSA-N |
| XLogP | 3.72 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|