C18H26NO+ — CID 170933905
(3aS,8bR)-4,4-dideuterio-3a,8b-dimethyl-1,2-di(propan-2-yl)indeno[1,2-d][1,3]oxazol-1-ium (PubChem CID 170933905) has the molecular formula C18H26NO+ and a molecular weight of 274.42 g/mol. Its IUPAC name is (3aS,8bR)-4,4-dideuterio-3a,8b-dimethyl-1,2-di(propan-2-yl)indeno[1,2-d][1,3]oxazol-1-ium.
| Compound Name | (3aS,8bR)-4,4-dideuterio-3a,8b-dimethyl-1,2-di(propan-2-yl)indeno[1,2-d][1,3]oxazol-1-ium |
|---|---|
| PubChem CID | 170933905 |
| Molecular Formula | C18H26NO+ |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (3aS,8bR)-4,4-dideuterio-3a,8b-dimethyl-1,2-di(propan-2-yl)indeno[1,2-d][1,3]oxazol-1-ium |
| SMILES | [2H]C1([2H])c2ccccc2[C@@]2(C)[N+](C(C)C)=C(C(C)C)O[C@@]12C |
| InChI | InChI=1S/C18H26NO/c1-12(2)16-19(13(3)4)18(6)15-10-8-7-9-14(15)11-17(18,5)20-16/h7-10,12-13H,11H2,1-6H3/q+1/t17-,18+/m0/s1/i11D2 |
| InChIKey | BDJODRKFDKGWPG-WGHMMKRDSA-N |
| XLogP | 3.72 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|