C28H39N2+ — CID 176815366
(3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-1-(2,3,5,6-tetramethylphenyl)-4H-indeno[1,2-d]imidazol-3-ium (PubChem CID 176815366) has the molecular formula C28H39N2+ and a molecular weight of 403.63 g/mol. Its IUPAC name is (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-1-(2,3,5,6-tetramethylphenyl)-4H-indeno[1,2-d]imidazol-3-ium.
| Compound Name | (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-1-(2,3,5,6-tetramethylphenyl)-4H-indeno[1,2-d]imidazol-3-ium |
|---|---|
| PubChem CID | 176815366 |
| Molecular Formula | C28H39N2+ |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | (3aR,8bS)-3a,8b-dimethyl-2,3-di(propan-2-yl)-1-(2,3,5,6-tetramethylphenyl)-4H-indeno[1,2-d]imidazol-3-ium |
| SMILES | Cc1cc(C)c(C)c(N2C(C(C)C)=[N+](C(C)C)[C@]3(C)Cc4ccccc4[C@]23C)c1C |
| InChI | InChI=1S/C28H39N2/c1-17(2)26-29(18(3)4)27(9)16-23-13-11-12-14-24(23)28(27,10)30(26)25-21(7)19(5)15-20(6)22(25)8/h11-15,17-18H,16H2,1-10H3/q+1/t27-,28+/m1/s1 |
| InChIKey | ZVLPEECMKSKCPX-IZLXSDGUSA-N |
| XLogP | 6.45 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|