C18H26NO+ — CID 176815413
(3aR,9aR)-4,4-dideuterio-3a-methyl-2,3-di(propan-2-yl)-9,9a-dihydrobenzo[f][1,3]benzoxazol-3-ium (PubChem CID 176815413) has the molecular formula C18H26NO+ and a molecular weight of 274.42 g/mol. Its IUPAC name is (3aR,9aR)-4,4-dideuterio-3a-methyl-2,3-di(propan-2-yl)-9,9a-dihydrobenzo[f][1,3]benzoxazol-3-ium.
| Compound Name | (3aR,9aR)-4,4-dideuterio-3a-methyl-2,3-di(propan-2-yl)-9,9a-dihydrobenzo[f][1,3]benzoxazol-3-ium |
|---|---|
| PubChem CID | 176815413 |
| Molecular Formula | C18H26NO+ |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (3aR,9aR)-4,4-dideuterio-3a-methyl-2,3-di(propan-2-yl)-9,9a-dihydrobenzo[f][1,3]benzoxazol-3-ium |
| SMILES | [2H]C1([2H])c2ccccc2C[C@H]2OC(C(C)C)=[N+](C(C)C)[C@@]21C |
| InChI | InChI=1S/C18H26NO/c1-12(2)17-19(13(3)4)18(5)11-15-9-7-6-8-14(15)10-16(18)20-17/h6-9,12-13,16H,10-11H2,1-5H3/q+1/t16-,18-/m1/s1/i11D2 |
| InChIKey | XAPKBMXZDKSMAP-KLTQHNOQSA-N |
| XLogP | 3.42 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|