C21H32 — CID 164779049
1,3-bis(1-deuteriocyclohexyl)-2-propan-2-ylbenzene (PubChem CID 164779049) has the molecular formula C21H32 and a molecular weight of 286.50 g/mol. Its IUPAC name is 1,3-bis(1-deuteriocyclohexyl)-2-propan-2-ylbenzene.
| Compound Name | 1,3-bis(1-deuteriocyclohexyl)-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 164779049 |
| Molecular Formula | C21H32 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 1,3-bis(1-deuteriocyclohexyl)-2-propan-2-ylbenzene |
| SMILES | [2H]C1(c2cccc(C3([2H])CCCCC3)c2C(C)C)CCCCC1 |
| InChI | InChI=1S/C21H32/c1-16(2)21-19(17-10-5-3-6-11-17)14-9-15-20(21)18-12-7-4-8-13-18/h9,14-18H,3-8,10-13H2,1-2H3/i17D,18D |
| InChIKey | OXIRPAYBACNIPE-IUKNHUCNSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |