C35H42ClN5O2S — CID 170946312
3-[4-[1-[4-[4-[4-(aminomethyl)-3-methylphenyl]thieno[2,3-b]pyridin-2-yl]butyl]piperidin-4-yl]anilino]piperidine-2,6-dione;hydrochloride (PubChem CID 170946312) has the molecular formula C35H42ClN5O2S and a molecular weight of 632.27 g/mol. Its IUPAC name is 3-[4-[1-[4-[4-[4-(aminomethyl)-3-methylphenyl]thieno[2,3-b]pyridin-2-yl]butyl]piperidin-4-yl]anilino]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[4-[1-[4-[4-[4-(aminomethyl)-3-methylphenyl]thieno[2,3-b]pyridin-2-yl]butyl]piperidin-4-yl]anilino]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170946312 |
| Molecular Formula | C35H42ClN5O2S |
| Molecular Weight | 632.27 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 3-[4-[1-[4-[4-[4-(aminomethyl)-3-methylphenyl]thieno[2,3-b]pyridin-2-yl]butyl]piperidin-4-yl]anilino]piperidine-2,6-dione;hydrochloride |
| SMILES | Cc1cc(-c2ccnc3sc(CCCCN4CCC(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)cc23)ccc1CN.Cl |
| InChI | InChI=1S/C35H41N5O2S.ClH/c1-23-20-26(5-6-27(23)22-36)30-13-16-37-35-31(30)21-29(43-35)4-2-3-17-40-18-14-25(15-19-40)24-7-9-28(10-8-24)38-32-11-12-33(41)39-34(32)42;/h5-10,13,16,20-21,25,32,38H,2-4,11-12,14-15,17-19,22,36H2,1H3,(H,39,41,42);1H |
| InChIKey | CAWBLCOUHONCDR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.27 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|