C11H13BrO — CID 170961451
2-[(2-bromo-4,6-dimethylphenyl)methyl]oxirane (PubChem CID 170961451) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-dimethylphenyl)methyl]oxirane.
| Compound Name | 2-[(2-bromo-4,6-dimethylphenyl)methyl]oxirane |
|---|---|
| PubChem CID | 170961451 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-[(2-bromo-4,6-dimethylphenyl)methyl]oxirane |
| SMILES | Cc1cc(C)c(CC2CO2)c(Br)c1 |
| InChI | InChI=1S/C11H13BrO/c1-7-3-8(2)10(11(12)4-7)5-9-6-13-9/h3-4,9H,5-6H2,1-2H3 |
| InChIKey | QDMGLFBKKHRKFC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|