C19H38N2O4 — CID 170966776
3-(3-methoxy-2,2-dimethylpropoxy)-2,2-dimethyl-N-[7-(methylamino)-2-oxoheptan-3-yl]propanamide (PubChem CID 170966776) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-(3-methoxy-2,2-dimethylpropoxy)-2,2-dimethyl-N-[7-(methylamino)-2-oxoheptan-3-yl]propanamide.
| Compound Name | 3-(3-methoxy-2,2-dimethylpropoxy)-2,2-dimethyl-N-[7-(methylamino)-2-oxoheptan-3-yl]propanamide |
|---|---|
| PubChem CID | 170966776 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 3-(3-methoxy-2,2-dimethylpropoxy)-2,2-dimethyl-N-[7-(methylamino)-2-oxoheptan-3-yl]propanamide |
| SMILES | CNCCCCC(NC(=O)C(C)(C)COCC(C)(C)COC)C(C)=O |
| InChI | InChI=1S/C19H38N2O4/c1-15(22)16(10-8-9-11-20-6)21-17(23)19(4,5)14-25-13-18(2,3)12-24-7/h16,20H,8-14H2,1-7H3,(H,21,23) |
| InChIKey | KEKMWWWLOBYWRC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|