C9H8BrN3 — CID 170968436
7-bromo-3-methyl-2,6-naphthyridin-1-amine (PubChem CID 170968436) has the molecular formula C9H8BrN3 and a molecular weight of 238.09 g/mol. Its IUPAC name is 7-bromo-3-methyl-2,6-naphthyridin-1-amine.
| Compound Name | 7-bromo-3-methyl-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 170968436 |
| Molecular Formula | C9H8BrN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 7-bromo-3-methyl-2,6-naphthyridin-1-amine |
| SMILES | Cc1cc2cnc(Br)cc2c(N)n1 |
| InChI | InChI=1S/C9H8BrN3/c1-5-2-6-4-12-8(10)3-7(6)9(11)13-5/h2-4H,1H3,(H2,11,13) |
| InChIKey | JBOCXLOMTDKNEE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|