C7H3ClN4S — CID 170973109
10-chloro-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene (PubChem CID 170973109) has the molecular formula C7H3ClN4S and a molecular weight of 210.65 g/mol. Its IUPAC name is 10-chloro-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene.
| Compound Name | 10-chloro-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene |
|---|---|
| PubChem CID | 170973109 |
| Molecular Formula | C7H3ClN4S |
| Molecular Weight | 210.65 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 10-chloro-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene |
| SMILES | Clc1ncc2c(n1)[nH]c1cnsc12 |
| InChI | InChI=1S/C7H3ClN4S/c8-7-9-1-3-5-4(2-10-13-5)11-6(3)12-7/h1-2H,(H,9,11,12) |
| InChIKey | IBNOHPBTZJGGAQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |