C12H25N3 — CID 170976169
1-[(2R,5S)-1,2,5-trimethylpiperidin-4-yl]piperazine (PubChem CID 170976169) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-[(2R,5S)-1,2,5-trimethylpiperidin-4-yl]piperazine.
| Compound Name | 1-[(2R,5S)-1,2,5-trimethylpiperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 170976169 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-[(2R,5S)-1,2,5-trimethylpiperidin-4-yl]piperazine |
| SMILES | C[C@@H]1CC(N2CCNCC2)[C@@H](C)CN1C |
| InChI | InChI=1S/C12H25N3/c1-10-9-14(3)11(2)8-12(10)15-6-4-13-5-7-15/h10-13H,4-9H2,1-3H3/t10-,11+,12?/m0/s1 |
| InChIKey | LFIREBIWTHMPSU-WIKAKEFZSA-N |
| XLogP | 0.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |