C16H16F4N2O3 — CID 170980314
(3Z)-3-(1-ethoxypropylidene)-6-fluoro-2-oxo-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide (PubChem CID 170980314) has the molecular formula C16H16F4N2O3 and a molecular weight of 360.31 g/mol. Its IUPAC name is (3Z)-3-(1-ethoxypropylidene)-6-fluoro-2-oxo-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide.
| Compound Name | (3Z)-3-(1-ethoxypropylidene)-6-fluoro-2-oxo-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 170980314 |
| Molecular Formula | C16H16F4N2O3 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (3Z)-3-(1-ethoxypropylidene)-6-fluoro-2-oxo-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
| SMILES | CCO/C(CC)=C1\C(=O)Nc2cc(F)c(C(=O)NCC(F)(F)F)cc21 |
| InChI | InChI=1S/C16H16F4N2O3/c1-3-12(25-4-2)13-9-5-8(14(23)21-7-16(18,19)20)10(17)6-11(9)22-15(13)24/h5-6H,3-4,7H2,1-2H3,(H,21,23)(H,22,24)/b13-12- |
| InChIKey | VINKDSKEFBIHSS-SEYXRHQNSA-N |
| XLogP | 3.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|