C25H22F3N3O4 — CID 170982898
3-[(3,3-difluorocyclobutyl)-(4-fluorophenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 170982898) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclobutyl)-(4-fluorophenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 3-[(3,3-difluorocyclobutyl)-(4-fluorophenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 170982898 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-[(3,3-difluorocyclobutyl)-(4-fluorophenyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C(C(c1ccc(F)cc1)C1CC(F)(F)C1)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H22F3N3O4/c26-15-4-1-12(2-5-15)20(14-10-25(27,28)11-14)21-17-9-13(22(29)33)3-6-16(17)24(35)31(21)18-7-8-19(32)30-23(18)34/h1-6,9,14,18,20-21H,7-8,10-11H2,(H2,29,33)(H,30,32,34) |
| InChIKey | CVJKJCRSVMAZBL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|