C21H21F4N3O4 — CID 164736135
3-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 164736135) has the molecular formula C21H21F4N3O4 and a molecular weight of 455.41 g/mol. Its IUPAC name is 3-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 3-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 164736135 |
| Molecular Formula | C21H21F4N3O4 |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1F)C([C@@H](C1CCCC1)C(F)(F)F)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H21F4N3O4/c22-16-11(18(26)30)6-5-10-14(16)17(15(21(23,24)25)9-3-1-2-4-9)28(20(10)32)12-7-8-13(29)27-19(12)31/h5-6,9,12,15,17H,1-4,7-8H2,(H2,26,30)(H,27,29,31)/t12?,15-,17?/m1/s1 |
| InChIKey | GCTLMTRUYGZHQD-YAJUMTOWSA-N |
| XLogP | 2.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|