C23H17F3N4O4 — CID 164736186
3-[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 164736186) has the molecular formula C23H17F3N4O4 and a molecular weight of 470.41 g/mol. Its IUPAC name is 3-[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 3-[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 164736186 |
| Molecular Formula | C23H17F3N4O4 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-[(1R)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | N#Cc1ccc([C@H](C2c3cc(C(N)=O)ccc3C(=O)N2C2CCC(=O)NC2=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N4O4/c24-23(25,26)18(12-3-1-11(10-27)2-4-12)19-15-9-13(20(28)32)5-6-14(15)22(34)30(19)16-7-8-17(31)29-21(16)33/h1-6,9,16,18-19H,7-8H2,(H2,28,32)(H,29,31,33)/t16?,18-,19?/m1/s1 |
| InChIKey | SIHQMTQAEJFAKT-CUYAVPTFSA-N |
| XLogP | 2.31 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|