C22H19ClFN3O4 — CID 164736217
3-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 164736217) has the molecular formula C22H19ClFN3O4 and a molecular weight of 443.86 g/mol. Its IUPAC name is 3-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 3-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 164736217 |
| Molecular Formula | C22H19ClFN3O4 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-[(1S)-1-(2-chloro-4-fluorophenyl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | C[C@@H](c1ccc(F)cc1Cl)C1c2cc(C(N)=O)ccc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H19ClFN3O4/c1-10(13-5-3-12(24)9-16(13)23)19-15-8-11(20(25)29)2-4-14(15)22(31)27(19)17-6-7-18(28)26-21(17)30/h2-5,8-10,17,19H,6-7H2,1H3,(H2,25,29)(H,26,28,30)/t10-,17?,19?/m0/s1 |
| InChIKey | STNJKYNMCSXTJN-QNVXYWCQSA-N |
| XLogP | 2.68 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|