C19H21N3O4 — CID 175522806
3-cyclobutyl-2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxoisoindole-5-carboxamide (PubChem CID 175522806) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-cyclobutyl-2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxoisoindole-5-carboxamide.
| Compound Name | 3-cyclobutyl-2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 175522806 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-cyclobutyl-2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxoisoindole-5-carboxamide |
| SMILES | CC1(C2CCC2)c2cc(C(N)=O)ccc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H21N3O4/c1-19(11-3-2-4-11)13-9-10(16(20)24)5-6-12(13)18(26)22(19)14-7-8-15(23)21-17(14)25/h5-6,9,11,14H,2-4,7-8H2,1H3,(H2,20,24)(H,21,23,25) |
| InChIKey | WHUGTDYWFNMODY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|