About bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate
bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate (PubChem CID 171084572) has the molecular formula C14H33NO3
and a molecular weight of 263.42 g/mol. Its IUPAC name is bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate.
Molecular Properties
| Compound Name | bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate |
| PubChem CID | 171084572 |
| Molecular Formula | C14H33NO3 |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.25 |
| IUPAC Name | bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate |
| SMILES | CC(C)CCCCCCC[O-].CC(O)[NH2+]C(C)O |
| InChI | InChI=1S/C10H21O.C4H11NO2/c1-10(2)8-6-4-3-5-7-9-11;1-3(6)5-4(2)7/h10H,3-9H2,1-2H3;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | RUQSVYUQCQUWQS-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate?
The IUPAC name of bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate (CID 171084572) is bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate.
What is the SMILES notation for bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate?
The canonical SMILES for bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate is CC(C)CCCCCCC[O-].CC(O)[NH2+]C(C)O.
What is the InChIKey of bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate?
The InChIKey is RUQSVYUQCQUWQS-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H21O.C4H11NO2/c1-10(2)8-6-4-3-5-7-9-11;1-3(6)5-4(2)7/h10H,3-9H2,1-2H3;3-7H,1-2H3/q-1;/p+1.
What are the key properties of bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate?
bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate has a molecular weight of 263.42 g/mol, XLogP of 0.57, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-hydroxyethyl)azanium;8-methylnonan-1-olate is sourced from PubChem (CID 171084572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).