C18H23BFNO2 — CID 171114092
3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1H-indole (PubChem CID 171114092) has the molecular formula C18H23BFNO2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1H-indole.
| Compound Name | 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1H-indole |
|---|---|
| PubChem CID | 171114092 |
| Molecular Formula | C18H23BFNO2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3-[3-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-1H-indole |
| SMILES | CC(Cc1c[nH]c2ccccc12)=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BFNO2/c1-12(10-13-11-21-15-9-7-6-8-14(13)15)16(20)19-22-17(2,3)18(4,5)23-19/h6-9,11,21H,10H2,1-5H3 |
| InChIKey | UWBDNPXWNRPHKH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|