C27H39NO3 — CID 171118623
(5E,7E)-8-[(3aS,4S,5R,7aR)-4-[(1Z,3E)-5-(2-methylbutylamino)-5-oxopenta-1,3-dienyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]octa-5,7-dienoic acid (PubChem CID 171118623) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (5E,7E)-8-[(3aS,4S,5R,7aR)-4-[(1Z,3E)-5-(2-methylbutylamino)-5-oxopenta-1,3-dienyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]octa-5,7-dienoic acid.
| Compound Name | (5E,7E)-8-[(3aS,4S,5R,7aR)-4-[(1Z,3E)-5-(2-methylbutylamino)-5-oxopenta-1,3-dienyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]octa-5,7-dienoic acid |
|---|---|
| PubChem CID | 171118623 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (5E,7E)-8-[(3aS,4S,5R,7aR)-4-[(1Z,3E)-5-(2-methylbutylamino)-5-oxopenta-1,3-dienyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]octa-5,7-dienoic acid |
| SMILES | CCC(C)CNC(=O)/C=C/C=C\[C@H]1[C@H]2CCC[C@@H]2C=C[C@H]1/C=C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C27H39NO3/c1-3-21(2)20-28-26(29)16-10-9-14-24-22(18-19-23-13-11-15-25(23)24)12-7-5-4-6-8-17-27(30)31/h4-5,7,9-10,12,14,16,18-19,21-25H,3,6,8,11,13,15,17,20H2,1-2H3,(H,28,29)(H,30,31)/b5-4+,12-7+,14-9-,16-10+/t21?,22-,23-,24-,25+/m1/s1 |
| InChIKey | WBGZKELJCWPLJG-LLNDUFDVSA-N |
| XLogP | 5.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|