C26H28F3N3O3 — CID 171142950
4-[7a-(methoxymethyl)-2-[2-(3-methoxyphenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171142950) has the molecular formula C26H28F3N3O3 and a molecular weight of 487.52 g/mol. Its IUPAC name is 4-[7a-(methoxymethyl)-2-[2-(3-methoxyphenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[7a-(methoxymethyl)-2-[2-(3-methoxyphenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171142950 |
| Molecular Formula | C26H28F3N3O3 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 4-[7a-(methoxymethyl)-2-[2-(3-methoxyphenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COCC12CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC1CN(C(=O)Cc1cccc(OC)c1)C2 |
| InChI | InChI=1S/C26H28F3N3O3/c1-34-17-25-8-9-31(21-7-6-19(13-30)23(12-21)26(27,28)29)14-20(25)15-32(16-25)24(33)11-18-4-3-5-22(10-18)35-2/h3-7,10,12,20H,8-9,11,14-17H2,1-2H3 |
| InChIKey | OLGVNAMILLSXMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |