C25H25F4N3O3 — CID 171143028
4-[5-(3-fluoro-4-methoxybenzoyl)-7a-(methoxymethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171143028) has the molecular formula C25H25F4N3O3 and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[5-(3-fluoro-4-methoxybenzoyl)-7a-(methoxymethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-(3-fluoro-4-methoxybenzoyl)-7a-(methoxymethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171143028 |
| Molecular Formula | C25H25F4N3O3 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 4-[5-(3-fluoro-4-methoxybenzoyl)-7a-(methoxymethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COCC12CCN(C(=O)c3ccc(OC)c(F)c3)CC1CN(c1ccc(C#N)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C25H25F4N3O3/c1-34-15-24-7-8-31(23(33)16-4-6-22(35-2)21(26)9-16)12-18(24)13-32(14-24)19-5-3-17(11-30)20(10-19)25(27,28)29/h3-6,9-10,18H,7-8,12-15H2,1-2H3 |
| InChIKey | OALXXYXITMTLSX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |