C25H26F3N3O2 — CID 171142917
4-[5-benzoyl-3a-(ethoxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171142917) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 4-[5-benzoyl-3a-(ethoxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-benzoyl-3a-(ethoxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171142917 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[5-benzoyl-3a-(ethoxymethyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCOCC12CN(C(=O)c3ccccc3)CCC1CN(c1ccc(C#N)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C25H26F3N3O2/c1-2-33-17-24-15-30(23(32)18-6-4-3-5-7-18)11-10-20(24)14-31(16-24)21-9-8-19(13-29)22(12-21)25(26,27)28/h3-9,12,20H,2,10-11,14-17H2,1H3 |
| InChIKey | GMRBIUXYIYNKIY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |