C24H32F3N3O2 — CID 171142972
4-[7a-(ethoxymethyl)-2-(2-ethylbutanoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171142972) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[7a-(ethoxymethyl)-2-(2-ethylbutanoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[7a-(ethoxymethyl)-2-(2-ethylbutanoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171142972 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[7a-(ethoxymethyl)-2-(2-ethylbutanoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCOCC12CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC1CN(C(=O)C(CC)CC)C2 |
| InChI | InChI=1S/C24H32F3N3O2/c1-4-17(5-2)22(31)30-14-19-13-29(10-9-23(19,15-30)16-32-6-3)20-8-7-18(12-28)21(11-20)24(25,26)27/h7-8,11,17,19H,4-6,9-10,13-16H2,1-3H3 |
| InChIKey | JSNXEQNCSYFPHR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |