C25H25F4N3O2 — CID 171142968
4-[7a-(ethoxymethyl)-2-(2-fluorobenzoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171142968) has the molecular formula C25H25F4N3O2 and a molecular weight of 475.49 g/mol. Its IUPAC name is 4-[7a-(ethoxymethyl)-2-(2-fluorobenzoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[7a-(ethoxymethyl)-2-(2-fluorobenzoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171142968 |
| Molecular Formula | C25H25F4N3O2 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[7a-(ethoxymethyl)-2-(2-fluorobenzoyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCOCC12CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC1CN(C(=O)c1ccccc1F)C2 |
| InChI | InChI=1S/C25H25F4N3O2/c1-2-34-16-24-9-10-31(19-8-7-17(12-30)21(11-19)25(27,28)29)13-18(24)14-32(15-24)23(33)20-5-3-4-6-22(20)26/h3-8,11,18H,2,9-10,13-16H2,1H3 |
| InChIKey | WLGKGZDFYBXUFP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |