C21H24F3N3O2 — CID 171143010
4-[7a-(hydroxymethyl)-5-(1-methylcyclopropanecarbonyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 171143010) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 4-[7a-(hydroxymethyl)-5-(1-methylcyclopropanecarbonyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[7a-(hydroxymethyl)-5-(1-methylcyclopropanecarbonyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171143010 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-[7a-(hydroxymethyl)-5-(1-methylcyclopropanecarbonyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C(=O)N2CCC3(CO)CN(c4ccc(C#N)c(C(F)(F)F)c4)CC3C2)CC1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-19(4-5-19)18(29)26-7-6-20(13-28)12-27(11-15(20)10-26)16-3-2-14(9-25)17(8-16)21(22,23)24/h2-3,8,15,28H,4-7,10-13H2,1H3 |
| InChIKey | QHFFHIURNCESKG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |