C23H23IN2S — CID 171149874
2-[(6,8-dimethyl-1-prop-2-enylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole iodide (PubChem CID 171149874) has the molecular formula C23H23IN2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2-[(6,8-dimethyl-1-prop-2-enylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole iodide.
| Compound Name | 2-[(6,8-dimethyl-1-prop-2-enylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 171149874 |
| Molecular Formula | C23H23IN2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2-[(6,8-dimethyl-1-prop-2-enylquinolin-1-ium-2-yl)methylidene]-3-methyl-1,3-benzothiazole iodide |
| SMILES | C=CC[n+]1c(C=C2Sc3ccccc3N2C)ccc2cc(C)cc(C)c21.[I-] |
| InChI | InChI=1S/C23H23N2S.HI/c1-5-12-25-19(11-10-18-14-16(2)13-17(3)23(18)25)15-22-24(4)20-8-6-7-9-21(20)26-22;/h5-11,13-15H,1,12H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | DTEPBIMYOLDQKD-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|