About 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol
3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol (PubChem CID 171192009) has the molecular formula C11H15Br3NO4P
and a molecular weight of 495.93 g/mol. Its IUPAC name is 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol.
Molecular Properties
| Compound Name | 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol |
| PubChem CID | 171192009 |
| Molecular Formula | C11H15Br3NO4P |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 492.83 |
| IUPAC Name | 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C11H15Br3NO4P/c1-3-18-20(17,19-4-2)11(15)8-6(12)5-7(13)10(16)9(8)14/h5,11,16H,3-4,15H2,1-2H3/t11-/m0/s1 |
| InChIKey | ZDJZFODYZAIDAP-NSHDSACASA-N |
| XLogP | 4.90 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol?
The IUPAC name of 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol (CID 171192009) is 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol.
What is the SMILES notation for 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol?
The canonical SMILES for 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol is CCOP(=O)(OCC)[C@H](N)c1c(Br)cc(Br)c(O)c1Br.
What is the InChIKey of 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol?
The InChIKey is ZDJZFODYZAIDAP-NSHDSACASA-N. The full InChI is InChI=1S/C11H15Br3NO4P/c1-3-18-20(17,19-4-2)11(15)8-6(12)5-7(13)10(16)9(8)14/h5,11,16H,3-4,15H2,1-2H3/t11-/m0/s1.
What are the key properties of 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol?
3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol has a molecular weight of 495.93 g/mol, XLogP of 4.90, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol is sourced from PubChem (CID 171192009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).