C11H15Br3NO4P — CID 171192009
3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol (PubChem CID 171192009) has the molecular formula C11H15Br3NO4P and a molecular weight of 495.93 g/mol. Its IUPAC name is 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 171192009 |
| Molecular Formula | C11H15Br3NO4P |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 492.83 |
| IUPAC Name | 3-[(S)-amino(diethoxyphosphoryl)methyl]-2,4,6-tribromophenol |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C11H15Br3NO4P/c1-3-18-20(17,19-4-2)11(15)8-6(12)5-7(13)10(16)9(8)14/h5,11,16H,3-4,15H2,1-2H3/t11-/m0/s1 |
| InChIKey | ZDJZFODYZAIDAP-NSHDSACASA-N |
| XLogP | 4.90 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|