C15H16F2N2OS — CID 171297657
3,5-difluoro-2-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171297657) has the molecular formula C15H16F2N2OS and a molecular weight of 310.37 g/mol. Its IUPAC name is 3,5-difluoro-2-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 3,5-difluoro-2-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171297657 |
| Molecular Formula | C15H16F2N2OS |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3,5-difluoro-2-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | Oc1cc(F)cc(F)c1[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H16F2N2OS/c16-10-8-11(17)14(12(20)9-10)15(13-2-1-7-21-13)19-5-3-18-4-6-19/h1-2,7-9,15,18,20H,3-6H2/t15-/m0/s1 |
| InChIKey | GFSZEIGVNRNIFD-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|