C36H36N4O5 — CID 171316391
6-[[4-[C-methyl-N-[[6-methyl-2-(4-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]carbonimidoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 171316391) has the molecular formula C36H36N4O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is 6-[[4-[C-methyl-N-[[6-methyl-2-(4-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]carbonimidoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[C-methyl-N-[[6-methyl-2-(4-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]carbonimidoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 171316391 |
| Molecular Formula | C36H36N4O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 6-[[4-[C-methyl-N-[[6-methyl-2-(4-propan-2-yloxyphenyl)quinoline-4-carbonyl]amino]carbonimidoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(=NNC(=O)c1cc(-c2ccc(OC(C)C)cc2)nc2ccc(C)cc12)c1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C36H36N4O5/c1-21(2)45-27-16-12-25(13-17-27)33-20-31(30-19-22(3)9-18-32(30)38-33)35(42)40-39-23(4)24-10-14-26(15-11-24)37-34(41)28-7-5-6-8-29(28)36(43)44/h5-6,9-21,28-29H,7-8H2,1-4H3,(H,37,41)(H,40,42)(H,43,44) |
| InChIKey | OCJZXWKIBUMTER-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|