C9H10BrNO4 — CID 171322873
(6,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)azanium bromide (PubChem CID 171322873) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is (6,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)azanium bromide.
| Compound Name | (6,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)azanium bromide |
|---|---|
| PubChem CID | 171322873 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (6,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)azanium bromide |
| SMILES | [Br-].[NH3+]C1Cc2cc(O)c(O)cc2OC1=O |
| InChI | InChI=1S/C9H9NO4.BrH/c10-5-1-4-2-6(11)7(12)3-8(4)14-9(5)13;/h2-3,5,11-12H,1,10H2;1H |
| InChIKey | ZOYRFGSUFXLPAW-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|