C34H32N2O4 — CID 171329113
bis(2-methylpropyl) 2,8-diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylate (PubChem CID 171329113) has the molecular formula C34H32N2O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,8-diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 2,8-diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylate |
|---|---|
| PubChem CID | 171329113 |
| Molecular Formula | C34H32N2O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | bis(2-methylpropyl) 2,8-diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylate |
| SMILES | CC(C)COC(=O)c1cc(-c2ccccc2)nc2cc3nc(-c4ccccc4)cc(C(=O)OCC(C)C)c3cc12 |
| InChI | InChI=1S/C34H32N2O4/c1-21(2)19-39-33(37)27-16-29(23-11-7-5-8-12-23)35-31-18-32-26(15-25(27)31)28(34(38)40-20-22(3)4)17-30(36-32)24-13-9-6-10-14-24/h5-18,21-22H,19-20H2,1-4H3 |
| InChIKey | PSTFSRVHPMITNS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|