C20H28Cl2N4 — CID 171329593
(3R,3aS,6aS)-2-methyl-3-phenyl-5-(4-propan-2-ylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171329593) has the molecular formula C20H28Cl2N4 and a molecular weight of 395.38 g/mol. Its IUPAC name is (3R,3aS,6aS)-2-methyl-3-phenyl-5-(4-propan-2-ylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aS)-2-methyl-3-phenyl-5-(4-propan-2-ylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171329593 |
| Molecular Formula | C20H28Cl2N4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3R,3aS,6aS)-2-methyl-3-phenyl-5-(4-propan-2-ylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | CC(C)c1ccnc(N2C[C@@H]3CN(C)[C@@H](c4ccccc4)[C@@H]3C2)n1.Cl.Cl |
| InChI | InChI=1S/C20H26N4.2ClH/c1-14(2)18-9-10-21-20(22-18)24-12-16-11-23(3)19(17(16)13-24)15-7-5-4-6-8-15;;/h4-10,14,16-17,19H,11-13H2,1-3H3;2*1H/t16-,17+,19-;;/m0../s1 |
| InChIKey | IPOOYGHMNURCCN-VLLIFGQUSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |