C23H16N4O4S2 — CID 171333666
2-cyano-3-(4-oxochromen-3-yl)-N-[5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171333666) has the molecular formula C23H16N4O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-cyano-3-(4-oxochromen-3-yl)-N-[5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-(4-oxochromen-3-yl)-N-[5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333666 |
| Molecular Formula | C23H16N4O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-cyano-3-(4-oxochromen-3-yl)-N-[5-(2-phenoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1coc2ccccc2c1=O)C(=O)Nc1nnc(SCCOc2ccccc2)s1 |
| InChI | InChI=1S/C23H16N4O4S2/c24-13-15(12-16-14-31-19-9-5-4-8-18(19)20(16)28)21(29)25-22-26-27-23(33-22)32-11-10-30-17-6-2-1-3-7-17/h1-9,12,14H,10-11H2,(H,25,26,29) |
| InChIKey | ZWJZHBGANNZYGO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|